C29H36N4O4 — CID 165127144
1-(oxan-2-yl)-3-[1-[4-(3-phenylmethoxypropoxy)butyl]pyrazol-4-yl]indazol-5-ol (PubChem CID 165127144) has the molecular formula C29H36N4O4 and a molecular weight of 504.63 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3-[1-[4-(3-phenylmethoxypropoxy)butyl]pyrazol-4-yl]indazol-5-ol.
| Compound Name | 1-(oxan-2-yl)-3-[1-[4-(3-phenylmethoxypropoxy)butyl]pyrazol-4-yl]indazol-5-ol |
|---|---|
| PubChem CID | 165127144 |
| Molecular Formula | C29H36N4O4 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | 1-(oxan-2-yl)-3-[1-[4-(3-phenylmethoxypropoxy)butyl]pyrazol-4-yl]indazol-5-ol |
| SMILES | Oc1ccc2c(c1)c(-c1cnn(CCCCOCCCOCc3ccccc3)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C29H36N4O4/c34-25-12-13-27-26(19-25)29(31-33(27)28-11-4-6-18-37-28)24-20-30-32(21-24)14-5-7-15-35-16-8-17-36-22-23-9-2-1-3-10-23/h1-3,9-10,12-13,19-21,28,34H,4-8,11,14-18,22H2 |
| InChIKey | XRIFKLTXPLNLEG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|