C19H17FN2O4 — CID 166835900
2-fluoro-5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]benzoic acid (PubChem CID 166835900) has the molecular formula C19H17FN2O4 and a molecular weight of 356.35 g/mol. Its IUPAC name is 2-fluoro-5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]benzoic acid.
| Compound Name | 2-fluoro-5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 166835900 |
| Molecular Formula | C19H17FN2O4 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-fluoro-5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2nn(C3CCCCO3)c3ccc(O)cc23)ccc1F |
| InChI | InChI=1S/C19H17FN2O4/c20-15-6-4-11(9-13(15)19(24)25)18-14-10-12(23)5-7-16(14)22(21-18)17-3-1-2-8-26-17/h4-7,9-10,17,23H,1-3,8H2,(H,24,25) |
| InChIKey | LAVRNGRJKUDNKZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |