C27H23FN2O3 — CID 22480234
4-[(E)-2-[3-(4-fluorophenyl)-1-(oxan-2-yl)indazol-5-yl]ethenyl]benzoic acid (PubChem CID 22480234) has the molecular formula C27H23FN2O3 and a molecular weight of 442.49 g/mol. Its IUPAC name is 4-[(E)-2-[3-(4-fluorophenyl)-1-(oxan-2-yl)indazol-5-yl]ethenyl]benzoic acid.
| Compound Name | 4-[(E)-2-[3-(4-fluorophenyl)-1-(oxan-2-yl)indazol-5-yl]ethenyl]benzoic acid |
|---|---|
| PubChem CID | 22480234 |
| Molecular Formula | C27H23FN2O3 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[(E)-2-[3-(4-fluorophenyl)-1-(oxan-2-yl)indazol-5-yl]ethenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=C/c2ccc3c(c2)c(-c2ccc(F)cc2)nn3C2CCCCO2)cc1 |
| InChI | InChI=1S/C27H23FN2O3/c28-22-13-11-20(12-14-22)26-23-17-19(5-4-18-6-9-21(10-7-18)27(31)32)8-15-24(23)30(29-26)25-3-1-2-16-33-25/h4-15,17,25H,1-3,16H2,(H,31,32)/b5-4+ |
| InChIKey | LIIBGUDTONENMI-SNAWJCMRSA-N |
| XLogP | 6.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|