C28H26N4O2 — CID 68908077
1-(oxan-2-yl)-3-[6-(pyrrolidine-1-carbonyl)naphthalen-2-yl]indazole-5-carbonitrile (PubChem CID 68908077) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3-[6-(pyrrolidine-1-carbonyl)naphthalen-2-yl]indazole-5-carbonitrile.
| Compound Name | 1-(oxan-2-yl)-3-[6-(pyrrolidine-1-carbonyl)naphthalen-2-yl]indazole-5-carbonitrile |
|---|---|
| PubChem CID | 68908077 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 1-(oxan-2-yl)-3-[6-(pyrrolidine-1-carbonyl)naphthalen-2-yl]indazole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c(-c1ccc3cc(C(=O)N4CCCC4)ccc3c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C28H26N4O2/c29-18-19-6-11-25-24(15-19)27(30-32(25)26-5-1-4-14-34-26)22-9-7-21-17-23(10-8-20(21)16-22)28(33)31-12-2-3-13-31/h6-11,15-17,26H,1-5,12-14H2 |
| InChIKey | LYDYKNLGUWCTGM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |