C19H16ClN3O — CID 22480117
3-(4-chlorophenyl)-1-(oxan-2-yl)indazole-5-carbonitrile (PubChem CID 22480117) has the molecular formula C19H16ClN3O and a molecular weight of 337.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(oxan-2-yl)indazole-5-carbonitrile.
| Compound Name | 3-(4-chlorophenyl)-1-(oxan-2-yl)indazole-5-carbonitrile |
|---|---|
| PubChem CID | 22480117 |
| Molecular Formula | C19H16ClN3O |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(oxan-2-yl)indazole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c(-c1ccc(Cl)cc1)nn2C1CCCCO1 |
| InChI | InChI=1S/C19H16ClN3O/c20-15-7-5-14(6-8-15)19-16-11-13(12-21)4-9-17(16)23(22-19)18-3-1-2-10-24-18/h4-9,11,18H,1-3,10H2 |
| InChIKey | SFHNCSQWFSYTQI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |