C18H16N4O — CID 22479759
1-(oxan-2-yl)-3-pyridin-3-ylindazole-5-carbonitrile (PubChem CID 22479759) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3-pyridin-3-ylindazole-5-carbonitrile.
| Compound Name | 1-(oxan-2-yl)-3-pyridin-3-ylindazole-5-carbonitrile |
|---|---|
| PubChem CID | 22479759 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1-(oxan-2-yl)-3-pyridin-3-ylindazole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)c(-c1cccnc1)nn2C1CCCCO1 |
| InChI | InChI=1S/C18H16N4O/c19-11-13-6-7-16-15(10-13)18(14-4-3-8-20-12-14)21-22(16)17-5-1-2-9-23-17/h3-4,6-8,10,12,17H,1-2,5,9H2 |
| InChIKey | GPLMEOBLJZQXQX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |