C33H38N4O2 — CID 68909557
3-[7-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propoxy]naphthalen-2-yl]-1-(oxan-2-yl)indazole-5-carbonitrile (PubChem CID 68909557) has the molecular formula C33H38N4O2 and a molecular weight of 522.69 g/mol. Its IUPAC name is 3-[7-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propoxy]naphthalen-2-yl]-1-(oxan-2-yl)indazole-5-carbonitrile.
| Compound Name | 3-[7-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propoxy]naphthalen-2-yl]-1-(oxan-2-yl)indazole-5-carbonitrile |
|---|---|
| PubChem CID | 68909557 |
| Molecular Formula | C33H38N4O2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | 3-[7-[3-[(2R,6S)-2,6-dimethylpiperidin-1-yl]propoxy]naphthalen-2-yl]-1-(oxan-2-yl)indazole-5-carbonitrile |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCOc1ccc2ccc(-c3nn(C4CCCCO4)c4ccc(C#N)cc34)cc2c1 |
| InChI | InChI=1S/C33H38N4O2/c1-23-7-5-8-24(2)36(23)16-6-18-38-29-14-13-26-11-12-27(20-28(26)21-29)33-30-19-25(22-34)10-15-31(30)37(35-33)32-9-3-4-17-39-32/h10-15,19-21,23-24,32H,3-9,16-18H2,1-2H3/t23-,24+,32? |
| InChIKey | JDFJWGZFDCRTSM-OHNATUCJSA-N |
| XLogP | 7.46 |
| TPSA | 63.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|