C19H17FN2O3 — CID 162677646
6-(4-fluorophenyl)-1-(oxan-2-yl)indazole-4-carboxylic acid (PubChem CID 162677646) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-(oxan-2-yl)indazole-4-carboxylic acid.
| Compound Name | 6-(4-fluorophenyl)-1-(oxan-2-yl)indazole-4-carboxylic acid |
|---|---|
| PubChem CID | 162677646 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 6-(4-fluorophenyl)-1-(oxan-2-yl)indazole-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)cc2)cc2c1cnn2C1CCCCO1 |
| InChI | InChI=1S/C19H17FN2O3/c20-14-6-4-12(5-7-14)13-9-15(19(23)24)16-11-21-22(17(16)10-13)18-3-1-2-8-25-18/h4-7,9-11,18H,1-3,8H2,(H,23,24) |
| InChIKey | LNKYFZPZDIRGPN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |