C24H23ClFN3O — CID 156879937
8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-ylpyrazolo[4,3-g]isoquinoline (PubChem CID 156879937) has the molecular formula C24H23ClFN3O and a molecular weight of 423.92 g/mol. Its IUPAC name is 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-ylpyrazolo[4,3-g]isoquinoline.
| Compound Name | 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-ylpyrazolo[4,3-g]isoquinoline |
|---|---|
| PubChem CID | 156879937 |
| Molecular Formula | C24H23ClFN3O |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 8-chloro-5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-ylpyrazolo[4,3-g]isoquinoline |
| SMILES | CC(C)c1nc(Cl)c2cc3c(cnn3C3CCCCO3)cc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23ClFN3O/c1-14(2)23-22(15-6-8-17(26)9-7-15)18-11-16-13-27-29(21-5-3-4-10-30-21)20(16)12-19(18)24(25)28-23/h6-9,11-14,21H,3-5,10H2,1-2H3 |
| InChIKey | VIWZETSKLMZZEP-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|