C24H26N4O3 — CID 166772105
5-(2-methoxy-4-pyridinyl)-1-(oxan-2-yl)-7-oxido-6-propan-2-ylpyrazolo[4,3-g]isoquinolin-7-ium (PubChem CID 166772105) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 5-(2-methoxy-4-pyridinyl)-1-(oxan-2-yl)-7-oxido-6-propan-2-ylpyrazolo[4,3-g]isoquinolin-7-ium.
| Compound Name | 5-(2-methoxy-4-pyridinyl)-1-(oxan-2-yl)-7-oxido-6-propan-2-ylpyrazolo[4,3-g]isoquinolin-7-ium |
|---|---|
| PubChem CID | 166772105 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 5-(2-methoxy-4-pyridinyl)-1-(oxan-2-yl)-7-oxido-6-propan-2-ylpyrazolo[4,3-g]isoquinolin-7-ium |
| SMILES | COc1cc(-c2c(C(C)C)[n+]([O-])cc3cc4c(cnn4C4CCCCO4)cc23)ccn1 |
| InChI | InChI=1S/C24H26N4O3/c1-15(2)24-23(16-7-8-25-21(12-16)30-3)19-10-17-13-26-28(22-6-4-5-9-31-22)20(17)11-18(19)14-27(24)29/h7-8,10-15,22H,4-6,9H2,1-3H3 |
| InChIKey | JFUBFIYZOCOZGG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|