C27H28F2N3O2+ — CID 156879840
5-(3,4-difluorophenyl)-7-methyl-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinolin-7-ium (PubChem CID 156879840) has the molecular formula C27H28F2N3O2+ and a molecular weight of 464.54 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-7-methyl-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinolin-7-ium.
| Compound Name | 5-(3,4-difluorophenyl)-7-methyl-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinolin-7-ium |
|---|---|
| PubChem CID | 156879840 |
| Molecular Formula | C27H28F2N3O2+ |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 5-(3,4-difluorophenyl)-7-methyl-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinolin-7-ium |
| SMILES | C[n+]1cc2cc3c(cnn3C3CCCCO3)cc2c(-c2ccc(F)c(F)c2)c1C1CCOCC1 |
| InChI | InChI=1S/C27H28F2N3O2/c1-31-16-20-14-24-19(15-30-32(24)25-4-2-3-9-34-25)12-21(20)26(18-5-6-22(28)23(29)13-18)27(31)17-7-10-33-11-8-17/h5-6,12-17,25H,2-4,7-11H2,1H3/q+1 |
| InChIKey | GJRBYOIIAYSCEF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|