C21H22FN5O — CID 146522029
10-(4-fluorophenyl)-4-(oxan-2-yl)-11-propan-2-yl-2,4,5,8,10-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene (PubChem CID 146522029) has the molecular formula C21H22FN5O and a molecular weight of 379.44 g/mol. Its IUPAC name is 10-(4-fluorophenyl)-4-(oxan-2-yl)-11-propan-2-yl-2,4,5,8,10-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene.
| Compound Name | 10-(4-fluorophenyl)-4-(oxan-2-yl)-11-propan-2-yl-2,4,5,8,10-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene |
|---|---|
| PubChem CID | 146522029 |
| Molecular Formula | C21H22FN5O |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 10-(4-fluorophenyl)-4-(oxan-2-yl)-11-propan-2-yl-2,4,5,8,10-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,5,7,11-pentaene |
| SMILES | CC(C)c1cc2nc3c(cnn3C3CCCCO3)nc2n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H22FN5O/c1-13(2)18-11-16-20(26(18)15-8-6-14(22)7-9-15)25-17-12-23-27(21(17)24-16)19-5-3-4-10-28-19/h6-9,11-13,19H,3-5,10H2,1-2H3 |
| InChIKey | NQRRNRYCRIXALS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |