C13H12F5N3O — CID 172739389
1-(oxan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-b]pyridine (PubChem CID 172739389) has the molecular formula C13H12F5N3O and a molecular weight of 321.25 g/mol. Its IUPAC name is 1-(oxan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-b]pyridine.
| Compound Name | 1-(oxan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 172739389 |
| Molecular Formula | C13H12F5N3O |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-(oxan-2-yl)-5-(1,1,2,2,2-pentafluoroethyl)pyrazolo[3,4-b]pyridine |
| SMILES | FC(F)(F)C(F)(F)c1cnc2c(cnn2C2CCCCO2)c1 |
| InChI | InChI=1S/C13H12F5N3O/c14-12(15,13(16,17)18)9-5-8-6-20-21(11(8)19-7-9)10-3-1-2-4-22-10/h5-7,10H,1-4H2 |
| InChIKey | IWRIYCFYQWMTBW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|