C11H11BrFN3O — CID 169212239
6-bromo-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridine (PubChem CID 169212239) has the molecular formula C11H11BrFN3O and a molecular weight of 300.13 g/mol. Its IUPAC name is 6-bromo-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridine.
| Compound Name | 6-bromo-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 169212239 |
| Molecular Formula | C11H11BrFN3O |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 6-bromo-5-fluoro-1-(oxan-2-yl)pyrazolo[3,4-b]pyridine |
| SMILES | Fc1cc2cnn(C3CCCCO3)c2nc1Br |
| InChI | InChI=1S/C11H11BrFN3O/c12-10-8(13)5-7-6-14-16(11(7)15-10)9-3-1-2-4-17-9/h5-6,9H,1-4H2 |
| InChIKey | CNGGLKOYDGAQCT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|