C20H19BrN2O — CID 156792609
5-bromo-1-(oxan-2-yl)-3-[(E)-2-phenylethenyl]indazole (PubChem CID 156792609) has the molecular formula C20H19BrN2O and a molecular weight of 383.29 g/mol. Its IUPAC name is 5-bromo-1-(oxan-2-yl)-3-[(E)-2-phenylethenyl]indazole.
| Compound Name | 5-bromo-1-(oxan-2-yl)-3-[(E)-2-phenylethenyl]indazole |
|---|---|
| PubChem CID | 156792609 |
| Molecular Formula | C20H19BrN2O |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 5-bromo-1-(oxan-2-yl)-3-[(E)-2-phenylethenyl]indazole |
| SMILES | Brc1ccc2c(c1)c(/C=C/c1ccccc1)nn2C1CCCCO1 |
| InChI | InChI=1S/C20H19BrN2O/c21-16-10-12-19-17(14-16)18(11-9-15-6-2-1-3-7-15)22-23(19)20-8-4-5-13-24-20/h1-3,6-7,9-12,14,20H,4-5,8,13H2/b11-9+ |
| InChIKey | GNVIZDYFIYRUAT-PKNBQFBNSA-N |
| XLogP | 5.67 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |