C13H12BrF3N2O — CID 129411061
5-bromo-1-[(2R)-oxan-2-yl]-3-(trifluoromethyl)indazole (PubChem CID 129411061) has the molecular formula C13H12BrF3N2O and a molecular weight of 349.15 g/mol. Its IUPAC name is 5-bromo-1-[(2R)-oxan-2-yl]-3-(trifluoromethyl)indazole.
| Compound Name | 5-bromo-1-[(2R)-oxan-2-yl]-3-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 129411061 |
| Molecular Formula | C13H12BrF3N2O |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 5-bromo-1-[(2R)-oxan-2-yl]-3-(trifluoromethyl)indazole |
| SMILES | FC(F)(F)c1nn([C@H]2CCCCO2)c2ccc(Br)cc12 |
| InChI | InChI=1S/C13H12BrF3N2O/c14-8-4-5-10-9(7-8)12(13(15,16)17)18-19(10)11-3-1-2-6-20-11/h4-5,7,11H,1-3,6H2/t11-/m1/s1 |
| InChIKey | POFZBJQIOBPMEZ-LLVKDONJSA-N |
| XLogP | 4.52 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |