C39H47BrF2N4O2Si — CID 157326177
5-bromo-3-fluoro-1-(oxan-2-yl)indazole;5-(2-cyclobutylethynyl)-3-fluoro-1-(oxan-2-yl)indazole;2-cyclobutylethynyl(trimethyl)silane (PubChem CID 157326177) has the molecular formula C39H47BrF2N4O2Si and a molecular weight of 749.82 g/mol. Its IUPAC name is 5-bromo-3-fluoro-1-(oxan-2-yl)indazole;5-(2-cyclobutylethynyl)-3-fluoro-1-(oxan-2-yl)indazole;2-cyclobutylethynyl(trimethyl)silane.
| Compound Name | 5-bromo-3-fluoro-1-(oxan-2-yl)indazole;5-(2-cyclobutylethynyl)-3-fluoro-1-(oxan-2-yl)indazole;2-cyclobutylethynyl(trimethyl)silane |
|---|---|
| PubChem CID | 157326177 |
| Molecular Formula | C39H47BrF2N4O2Si |
| Molecular Weight | 749.82 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | 5-bromo-3-fluoro-1-(oxan-2-yl)indazole;5-(2-cyclobutylethynyl)-3-fluoro-1-(oxan-2-yl)indazole;2-cyclobutylethynyl(trimethyl)silane |
| SMILES | C[Si](C)(C)C#CC1CCC1.Fc1nn(C2CCCCO2)c2ccc(Br)cc12.Fc1nn(C2CCCCO2)c2ccc(C#CC3CCC3)cc12 |
| InChI | InChI=1S/C18H19FN2O.C12H12BrFN2O.C9H16Si/c19-18-15-12-14(8-7-13-4-3-5-13)9-10-16(15)21(20-18)17-6-1-2-11-22-17;13-8-4-5-10-9(7-8)12(14)15-16(10)11-3-1-2-6-17-11;1-10(2,3)8-7-9-5-4-6-9/h9-10,12-13,17H,1-6,11H2;4-5,7,11H,1-3,6H2;9H,4-6H2,1-3H3 |
| InChIKey | BETAPFLVESGEBP-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.82 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|