C36H57B2FN2O5 — CID 154620217
5-[(Z)-1,2-bis(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole (PubChem CID 154620217) has the molecular formula C36H57B2FN2O5 and a molecular weight of 638.48 g/mol. Its IUPAC name is 5-[(Z)-1,2-bis(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole.
| Compound Name | 5-[(Z)-1,2-bis(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 154620217 |
| Molecular Formula | C36H57B2FN2O5 |
| Molecular Weight | 638.48 g/mol |
| Exact Mass | 638.44 |
| IUPAC Name | 5-[(Z)-1,2-bis(4,4,5,5-tetraethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-3-fluoro-1-(oxan-2-yl)indazole |
| SMILES | CC/C(B1OC(CC)(CC)C(CC)(CC)O1)=C(/B1OC(CC)(CC)C(CC)(CC)O1)c1ccc2c(c1)c(F)nn2C1CCCCO1 |
| InChI | InChI=1S/C36H57B2FN2O5/c1-10-28(37-43-33(11-2,12-3)34(13-4,14-5)44-37)31(38-45-35(15-6,16-7)36(17-8,18-9)46-38)26-22-23-29-27(25-26)32(39)40-41(29)30-21-19-20-24-42-30/h22-23,25,30H,10-21,24H2,1-9H3/b31-28- |
| InChIKey | SATSCJTUGFHRTK-PNOGMODKSA-N |
| XLogP | 9.42 |
| TPSA | 63.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.48 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|