C34H43BF4N4O6 — CID 175122134
tert-butyl N-[2-[[5-[(E)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate (PubChem CID 175122134) has the molecular formula C34H43BF4N4O6 and a molecular weight of 690.54 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[(E)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[(E)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 175122134 |
| Molecular Formula | C34H43BF4N4O6 |
| Molecular Weight | 690.54 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | tert-butyl N-[2-[[5-[(E)-4,4,4-trifluoro-1-[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-2-pyridinyl]oxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(/C(=C(/CC(F)(F)F)B2OC(C)(C)C(C)(C)O2)c2ccc3c(c2)c(F)nn3C2CCCCO2)cn1 |
| InChI | InChI=1S/C34H43BF4N4O6/c1-31(2,3)47-30(44)40-15-17-45-26-14-12-22(20-41-26)28(24(19-34(37,38)39)35-48-32(4,5)33(6,7)49-35)21-11-13-25-23(18-21)29(36)42-43(25)27-10-8-9-16-46-27/h11-14,18,20,27H,8-10,15-17,19H2,1-7H3,(H,40,44)/b28-24- |
| InChIKey | LCVGTONQLLAZFM-COOPMVRXSA-N |
| XLogP | 7.56 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.54 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|