C18H27BrN2O2Si — CID 169448982
[3-bromo-1-(oxan-2-yl)indazol-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 169448982) has the molecular formula C18H27BrN2O2Si and a molecular weight of 411.42 g/mol. Its IUPAC name is [3-bromo-1-(oxan-2-yl)indazol-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [3-bromo-1-(oxan-2-yl)indazol-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 169448982 |
| Molecular Formula | C18H27BrN2O2Si |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [3-bromo-1-(oxan-2-yl)indazol-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)c(Br)nn2C1CCCCO1 |
| InChI | InChI=1S/C18H27BrN2O2Si/c1-18(2,3)24(4,5)23-13-9-10-15-14(12-13)17(19)20-21(15)16-8-6-7-11-22-16/h9-10,12,16H,6-8,11H2,1-5H3 |
| InChIKey | SZQUGTUEJSURRM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|