C27H39N5O2SSi — CID 165127912
tert-butyl-dimethyl-[3-(2-methylsulfanyl-6-pyrrolidin-1-ylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]oxysilane (PubChem CID 165127912) has the molecular formula C27H39N5O2SSi and a molecular weight of 525.80 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-(2-methylsulfanyl-6-pyrrolidin-1-ylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[3-(2-methylsulfanyl-6-pyrrolidin-1-ylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]oxysilane |
|---|---|
| PubChem CID | 165127912 |
| Molecular Formula | C27H39N5O2SSi |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | tert-butyl-dimethyl-[3-(2-methylsulfanyl-6-pyrrolidin-1-ylpyrimidin-4-yl)-1-(oxan-2-yl)indazol-5-yl]oxysilane |
| SMILES | CSc1nc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C27H39N5O2SSi/c1-27(2,3)36(5,6)34-19-12-13-22-20(17-19)25(30-32(22)24-11-7-10-16-33-24)21-18-23(29-26(28-21)35-4)31-14-8-9-15-31/h12-13,17-18,24H,7-11,14-16H2,1-6H3 |
| InChIKey | UIZQGJQFXKZFLA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|