C28H43N3O4SSi — CID 174209896
4-[3-[2-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-4-yl]propoxy]butan-2-ol (PubChem CID 174209896) has the molecular formula C28H43N3O4SSi and a molecular weight of 545.82 g/mol. Its IUPAC name is 4-[3-[2-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-4-yl]propoxy]butan-2-ol.
| Compound Name | 4-[3-[2-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-4-yl]propoxy]butan-2-ol |
|---|---|
| PubChem CID | 174209896 |
| Molecular Formula | C28H43N3O4SSi |
| Molecular Weight | 545.82 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 4-[3-[2-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]-1,3-thiazol-4-yl]propoxy]butan-2-ol |
| SMILES | CC(O)CCOCCCc1csc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)n1 |
| InChI | InChI=1S/C28H43N3O4SSi/c1-20(32)14-17-33-15-9-10-21-19-36-27(29-21)26-23-18-22(35-37(5,6)28(2,3)4)12-13-24(23)31(30-26)25-11-7-8-16-34-25/h12-13,18-20,25,32H,7-11,14-17H2,1-6H3 |
| InChIKey | ATDGPFBWHPSRIF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.82 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|