C29H46N4O4Si — CID 174204806
4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]-2-methylpropoxy]butan-2-ol (PubChem CID 174204806) has the molecular formula C29H46N4O4Si and a molecular weight of 542.80 g/mol. Its IUPAC name is 4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]-2-methylpropoxy]butan-2-ol.
| Compound Name | 4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]-2-methylpropoxy]butan-2-ol |
|---|---|
| PubChem CID | 174204806 |
| Molecular Formula | C29H46N4O4Si |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 4-[3-[4-[5-[tert-butyl(dimethyl)silyl]oxy-1-(oxan-2-yl)indazol-3-yl]pyrazol-1-yl]-2-methylpropoxy]butan-2-ol |
| SMILES | CC(O)CCOCC(C)Cn1cc(-c2nn(C3CCCCO3)c3ccc(O[Si](C)(C)C(C)(C)C)cc23)cn1 |
| InChI | InChI=1S/C29H46N4O4Si/c1-21(20-35-15-13-22(2)34)18-32-19-23(17-30-32)28-25-16-24(37-38(6,7)29(3,4)5)11-12-26(25)33(31-28)27-10-8-9-14-36-27/h11-12,16-17,19,21-22,27,34H,8-10,13-15,18,20H2,1-7H3 |
| InChIKey | VKMSPRDWCMSCTJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|