C23H30F2N4O5Si — CID 165127799
2,2-difluoro-2-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxyacetic acid (PubChem CID 165127799) has the molecular formula C23H30F2N4O5Si and a molecular weight of 508.60 g/mol. Its IUPAC name is 2,2-difluoro-2-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxyacetic acid.
| Compound Name | 2,2-difluoro-2-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxyacetic acid |
|---|---|
| PubChem CID | 165127799 |
| Molecular Formula | C23H30F2N4O5Si |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 2,2-difluoro-2-[1-(oxan-2-yl)-3-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]indazol-5-yl]oxyacetic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(-c2nn(C3CCCCO3)c3ccc(OC(F)(F)C(=O)O)cc23)cn1 |
| InChI | InChI=1S/C23H30F2N4O5Si/c1-35(2,3)11-10-32-15-28-14-16(13-26-28)21-18-12-17(34-23(24,25)22(30)31)7-8-19(18)29(27-21)20-6-4-5-9-33-20/h7-8,12-14,20H,4-6,9-11,15H2,1-3H3,(H,30,31) |
| InChIKey | VZPSCJNIUXHLDP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|