C23H28N4O3 — CID 165127830
1-(oxan-2-yl)-5-(2-prop-2-enoxyethoxy)-3-(1-prop-2-enylpyrazol-4-yl)indazole (PubChem CID 165127830) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 1-(oxan-2-yl)-5-(2-prop-2-enoxyethoxy)-3-(1-prop-2-enylpyrazol-4-yl)indazole.
| Compound Name | 1-(oxan-2-yl)-5-(2-prop-2-enoxyethoxy)-3-(1-prop-2-enylpyrazol-4-yl)indazole |
|---|---|
| PubChem CID | 165127830 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-(oxan-2-yl)-5-(2-prop-2-enoxyethoxy)-3-(1-prop-2-enylpyrazol-4-yl)indazole |
| SMILES | C=CCOCCOc1ccc2c(c1)c(-c1cnn(CC=C)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C23H28N4O3/c1-3-10-26-17-18(16-24-26)23-20-15-19(29-14-13-28-11-4-2)8-9-21(20)27(25-23)22-7-5-6-12-30-22/h3-4,8-9,15-17,22H,1-2,5-7,10-14H2 |
| InChIKey | WADCNRKDAIKYQZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|