C25H33N3O7S — CID 170698515
[(2R)-4-[(2S)-2-[[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]oxy]propoxy]butan-2-yl] methanesulfonate (PubChem CID 170698515) has the molecular formula C25H33N3O7S and a molecular weight of 519.62 g/mol. Its IUPAC name is [(2R)-4-[(2S)-2-[[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]oxy]propoxy]butan-2-yl] methanesulfonate.
| Compound Name | [(2R)-4-[(2S)-2-[[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]oxy]propoxy]butan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 170698515 |
| Molecular Formula | C25H33N3O7S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [(2R)-4-[(2S)-2-[[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]oxy]propoxy]butan-2-yl] methanesulfonate |
| SMILES | C[C@H](CCOC[C@H](C)Oc1cncc(-c2nn(C3CCCCO3)c3ccc(O)cc23)c1)OS(C)(=O)=O |
| InChI | InChI=1S/C25H33N3O7S/c1-17(35-36(3,30)31)9-11-32-16-18(2)34-21-12-19(14-26-15-21)25-22-13-20(29)7-8-23(22)28(27-25)24-6-4-5-10-33-24/h7-8,12-15,17-18,24,29H,4-6,9-11,16H2,1-3H3/t17-,18+,24?/m1/s1 |
| InChIKey | VWRNNJPZUJGNMA-IHHKOXMGSA-N |
| XLogP | 4.04 |
| TPSA | 122.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|