C25H33N3O7S — CID 172723181
(2R)-3-[2-[(1S)-1-[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]-2-methylpropane-1-sulfonic acid (PubChem CID 172723181) has the molecular formula C25H33N3O7S and a molecular weight of 519.62 g/mol. Its IUPAC name is (2R)-3-[2-[(1S)-1-[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]-2-methylpropane-1-sulfonic acid.
| Compound Name | (2R)-3-[2-[(1S)-1-[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 172723181 |
| Molecular Formula | C25H33N3O7S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (2R)-3-[2-[(1S)-1-[5-[5-hydroxy-1-(oxan-2-yl)indazol-3-yl]-3-pyridinyl]ethoxy]ethoxy]-2-methylpropane-1-sulfonic acid |
| SMILES | C[C@H](COCCO[C@@H](C)c1cncc(-c2nn(C3CCCCO3)c3ccc(O)cc23)c1)CS(=O)(=O)O |
| InChI | InChI=1S/C25H33N3O7S/c1-17(16-36(30,31)32)15-33-9-10-34-18(2)19-11-20(14-26-13-19)25-22-12-21(29)6-7-23(22)28(27-25)24-5-3-4-8-35-24/h6-7,11-14,17-18,24,29H,3-5,8-10,15-16H2,1-2H3,(H,30,31,32)/t17-,18+,24?/m1/s1 |
| InChIKey | GUGNHFZNUVKGNI-IHHKOXMGSA-N |
| XLogP | 4.12 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|