C24H30N4O4 — CID 66831605
1-(oxan-2-yl)-3-[2-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]ethenyl]indazol-5-ol (PubChem CID 66831605) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3-[2-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]ethenyl]indazol-5-ol.
| Compound Name | 1-(oxan-2-yl)-3-[2-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]ethenyl]indazol-5-ol |
|---|---|
| PubChem CID | 66831605 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-(oxan-2-yl)-3-[2-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]ethenyl]indazol-5-ol |
| SMILES | Oc1ccc2c(c1)c(C=Cc1cnn(CCOC3CCCCO3)c1)nn2C1CCCCO1 |
| InChI | InChI=1S/C24H30N4O4/c29-19-8-10-22-20(15-19)21(26-28(22)23-5-1-3-12-30-23)9-7-18-16-25-27(17-18)11-14-32-24-6-2-4-13-31-24/h7-10,15-17,23-24,29H,1-6,11-14H2 |
| InChIKey | OTSOEGQVEWDEHX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |