C16H29BN2O5 — CID 45382218
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]borinic acid (PubChem CID 45382218) has the molecular formula C16H29BN2O5 and a molecular weight of 340.23 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]borinic acid |
|---|---|
| PubChem CID | 45382218 |
| Molecular Formula | C16H29BN2O5 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[1-[2-(oxan-2-yloxy)ethyl]pyrazol-4-yl]borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cnn(CCOC2CCCCO2)c1 |
| InChI | InChI=1S/C16H29BN2O5/c1-15(2,20)16(3,4)24-17(21)13-11-18-19(12-13)8-10-23-14-7-5-6-9-22-14/h11-12,14,20-21H,5-10H2,1-4H3 |
| InChIKey | RVJPUWIRGSVHLM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|