C14H25BN2O4 — CID 99773848
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-[(2S)-oxan-2-yl]imidazol-4-yl]borinic acid (PubChem CID 99773848) has the molecular formula C14H25BN2O4 and a molecular weight of 296.18 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-[(2S)-oxan-2-yl]imidazol-4-yl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-[(2S)-oxan-2-yl]imidazol-4-yl]borinic acid |
|---|---|
| PubChem CID | 99773848 |
| Molecular Formula | C14H25BN2O4 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[3-[(2S)-oxan-2-yl]imidazol-4-yl]borinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)c1cncn1[C@@H]1CCCCO1 |
| InChI | InChI=1S/C14H25BN2O4/c1-13(2,18)14(3,4)21-15(19)11-9-16-10-17(11)12-7-5-6-8-20-12/h9-10,12,18-19H,5-8H2,1-4H3/t12-/m0/s1 |
| InChIKey | RAKXXSAMNAABIA-LBPRGKRZSA-N |
| XLogP | 0.84 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|