C17H28BNO4 — CID 67008420
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(2-methylmorpholin-4-yl)phenyl]borinic acid (PubChem CID 67008420) has the molecular formula C17H28BNO4 and a molecular weight of 321.23 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(2-methylmorpholin-4-yl)phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(2-methylmorpholin-4-yl)phenyl]borinic acid |
|---|---|
| PubChem CID | 67008420 |
| Molecular Formula | C17H28BNO4 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(2-methylmorpholin-4-yl)phenyl]borinic acid |
| SMILES | CC1CN(c2ccc(B(O)OC(C)(C)C(C)(C)O)cc2)CCO1 |
| InChI | InChI=1S/C17H28BNO4/c1-13-12-19(10-11-22-13)15-8-6-14(7-9-15)18(21)23-17(4,5)16(2,3)20/h6-9,13,20-21H,10-12H2,1-5H3 |
| InChIKey | RXAKXALKFTXBLH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|