C19H33BN2O3 — CID 131700797
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]borinic acid (PubChem CID 131700797) has the molecular formula C19H33BN2O3 and a molecular weight of 348.30 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]borinic acid |
|---|---|
| PubChem CID | 131700797 |
| Molecular Formula | C19H33BN2O3 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]borinic acid |
| SMILES | CC(C)N1CCN(c2ccc(B(O)OC(C)(C)C(C)(C)O)cc2)CC1 |
| InChI | InChI=1S/C19H33BN2O3/c1-15(2)21-11-13-22(14-12-21)17-9-7-16(8-10-17)20(24)25-19(5,6)18(3,4)23/h7-10,15,23-24H,11-14H2,1-6H3 |
| InChIKey | QJHZHNNKXYVPNN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|