C19H35BN2O5 — CID 175523136
2,3-dimethylbutane-2,3-diol;[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]boronic acid (PubChem CID 175523136) has the molecular formula C19H35BN2O5 and a molecular weight of 382.31 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]boronic acid.
| Compound Name | 2,3-dimethylbutane-2,3-diol;[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]boronic acid |
|---|---|
| PubChem CID | 175523136 |
| Molecular Formula | C19H35BN2O5 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;[4-(4-propan-2-ylpiperazin-1-yl)phenoxy]boronic acid |
| SMILES | CC(C)(O)C(C)(C)O.CC(C)N1CCN(c2ccc(OB(O)O)cc2)CC1 |
| InChI | InChI=1S/C13H21BN2O3.C6H14O2/c1-11(2)15-7-9-16(10-8-15)12-3-5-13(6-4-12)19-14(17)18;1-5(2,7)6(3,4)8/h3-6,11,17-18H,7-10H2,1-2H3;7-8H,1-4H3 |
| InChIKey | IDBNQRDVRWIBKL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|