C14H23BN2O3 — CID 142785030
[3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenoxy]boronic acid (PubChem CID 142785030) has the molecular formula C14H23BN2O3 and a molecular weight of 278.16 g/mol. Its IUPAC name is [3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenoxy]boronic acid.
| Compound Name | [3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 142785030 |
| Molecular Formula | C14H23BN2O3 |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | [3-[(4-propan-2-ylpiperazin-1-yl)methyl]phenoxy]boronic acid |
| SMILES | CC(C)N1CCN(Cc2cccc(OB(O)O)c2)CC1 |
| InChI | InChI=1S/C14H23BN2O3/c1-12(2)17-8-6-16(7-9-17)11-13-4-3-5-14(10-13)20-15(18)19/h3-5,10,12,18-19H,6-9,11H2,1-2H3 |
| InChIKey | VBLWBPRCZHKHGD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|