C28H33N5O5 — CID 166836137
benzyl N-[3-[3-[1-(2-hydroxyethyl)pyrazol-3-yl]-1-(oxan-2-yl)indazol-5-yl]oxypropyl]carbamate (PubChem CID 166836137) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is benzyl N-[3-[3-[1-(2-hydroxyethyl)pyrazol-3-yl]-1-(oxan-2-yl)indazol-5-yl]oxypropyl]carbamate.
| Compound Name | benzyl N-[3-[3-[1-(2-hydroxyethyl)pyrazol-3-yl]-1-(oxan-2-yl)indazol-5-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 166836137 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | benzyl N-[3-[3-[1-(2-hydroxyethyl)pyrazol-3-yl]-1-(oxan-2-yl)indazol-5-yl]oxypropyl]carbamate |
| SMILES | O=C(NCCCOc1ccc2c(c1)c(-c1ccn(CCO)n1)nn2C1CCCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C28H33N5O5/c34-16-15-32-14-12-24(30-32)27-23-19-22(10-11-25(23)33(31-27)26-9-4-5-17-37-26)36-18-6-13-29-28(35)38-20-21-7-2-1-3-8-21/h1-3,7-8,10-12,14,19,26,34H,4-6,9,13,15-18,20H2,(H,29,35) |
| InChIKey | BQUAOZZNDHCPNJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|