C22H30N6O4 — CID 166835936
2-[4-[5-[4-(methylamino)butan-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]ethyl formate (PubChem CID 166835936) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-[4-[5-[4-(methylamino)butan-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]ethyl formate.
| Compound Name | 2-[4-[5-[4-(methylamino)butan-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]ethyl formate |
|---|---|
| PubChem CID | 166835936 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[4-[5-[4-(methylamino)butan-2-yloxy]-1-(oxan-2-yl)indazol-3-yl]triazol-2-yl]ethyl formate |
| SMILES | CNCCC(C)Oc1ccc2c(c1)c(-c1cnn(CCOC=O)n1)nn2C1CCCCO1 |
| InChI | InChI=1S/C22H30N6O4/c1-16(8-9-23-2)32-17-6-7-20-18(13-17)22(26-28(20)21-5-3-4-11-31-21)19-14-24-27(25-19)10-12-30-15-29/h6-7,13-16,21,23H,3-5,8-12H2,1-2H3 |
| InChIKey | QNLLIIDTVAKOTK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|