C24H21Cl3N4O2 — CID 156565616
3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole (PubChem CID 156565616) has the molecular formula C24H21Cl3N4O2 and a molecular weight of 503.82 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole.
| Compound Name | 3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 156565616 |
| Molecular Formula | C24H21Cl3N4O2 |
| Molecular Weight | 503.82 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole |
| SMILES | C[C@@H](Oc1ccc2c(c1)c(-c1ccc(Cl)nc1)nn2C1CCCCO1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C24H21Cl3N4O2/c1-14(23-18(25)12-28-13-19(23)26)33-16-6-7-20-17(10-16)24(15-5-8-21(27)29-11-15)30-31(20)22-4-2-3-9-32-22/h5-8,10-14,22H,2-4,9H2,1H3/t14-,22?/m1/s1 |
| InChIKey | OMUGEAGEWKXRGF-HNNQXCQYSA-N |
| XLogP | 7.29 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.82 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|