C30H30BCl2N6O3 — CID 171408859
CID 171408859 (PubChem CID 171408859) has the molecular formula C30H30BCl2N6O3 and a molecular weight of 604.33 g/mol.
| Compound Name | CID 171408859 |
|---|---|
| PubChem CID | 171408859 |
| Molecular Formula | C30H30BCl2N6O3 |
| Molecular Weight | 604.33 g/mol |
| Exact Mass | 603.18 |
| IUPAC Name | — |
| SMILES | C[C@@H](Oc1ccc2c(c1)c(-c1ccc(N3CC4CC(C3)N4[B]C=O)nc1)nn2C1CCCCO1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C30H30BCl2N6O3/c1-18(29-24(32)13-34-14-25(29)33)42-22-6-7-26-23(11-22)30(36-39(26)28-4-2-3-9-41-28)19-5-8-27(35-12-19)37-15-20-10-21(16-37)38(20)31-17-40/h5-8,11-14,17-18,20-21,28H,2-4,9-10,15-16H2,1H3/t18-,20?,21?,28?/m1/s1 |
| InChIKey | DHUCVKNDAACQEX-SOILWWKBSA-N |
| XLogP | 5.71 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.33 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|