C21H21Cl2N3O3 — CID 162373759
5-[1-(3,5-dichloro-4-pyridinyl)propoxy]-1-(oxan-2-yl)indazole-3-carbaldehyde (PubChem CID 162373759) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 5-[1-(3,5-dichloro-4-pyridinyl)propoxy]-1-(oxan-2-yl)indazole-3-carbaldehyde.
| Compound Name | 5-[1-(3,5-dichloro-4-pyridinyl)propoxy]-1-(oxan-2-yl)indazole-3-carbaldehyde |
|---|---|
| PubChem CID | 162373759 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 5-[1-(3,5-dichloro-4-pyridinyl)propoxy]-1-(oxan-2-yl)indazole-3-carbaldehyde |
| SMILES | CCC(Oc1ccc2c(c1)c(C=O)nn2C1CCCCO1)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C21H21Cl2N3O3/c1-2-19(21-15(22)10-24-11-16(21)23)29-13-6-7-18-14(9-13)17(12-27)25-26(18)20-5-3-4-8-28-20/h6-7,9-12,19-20H,2-5,8H2,1H3 |
| InChIKey | IPOFZAZOFQMVIE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|