C24H30Cl2N3O6P — CID 134593757
[5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazol-3-yl]-diethoxyphosphorylmethanol (PubChem CID 134593757) has the molecular formula C24H30Cl2N3O6P and a molecular weight of 558.40 g/mol. Its IUPAC name is [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazol-3-yl]-diethoxyphosphorylmethanol.
| Compound Name | [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazol-3-yl]-diethoxyphosphorylmethanol |
|---|---|
| PubChem CID | 134593757 |
| Molecular Formula | C24H30Cl2N3O6P |
| Molecular Weight | 558.40 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | [5-[1-(3,5-dichloro-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazol-3-yl]-diethoxyphosphorylmethanol |
| SMILES | CCOP(=O)(OCC)C(O)c1nn(C2CCCCO2)c2ccc(OC(C)c3c(Cl)cncc3Cl)cc12 |
| InChI | InChI=1S/C24H30Cl2N3O6P/c1-4-33-36(31,34-5-2)24(30)23-17-12-16(35-15(3)22-18(25)13-27-14-19(22)26)9-10-20(17)29(28-23)21-8-6-7-11-32-21/h9-10,12-15,21,24,30H,4-8,11H2,1-3H3 |
| InChIKey | ZBZQLTADWSJXJT-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.40 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|