C25H23Cl3N4O2 — CID 156578188
3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole (PubChem CID 156578188) has the molecular formula C25H23Cl3N4O2 and a molecular weight of 517.84 g/mol. Its IUPAC name is 3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole.
| Compound Name | 3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole |
|---|---|
| PubChem CID | 156578188 |
| Molecular Formula | C25H23Cl3N4O2 |
| Molecular Weight | 517.84 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 3-(6-chloro-3-pyridinyl)-5-[(1R)-1-(3,5-dichloro-2-methyl-4-pyridinyl)ethoxy]-1-(oxan-2-yl)indazole |
| SMILES | Cc1ncc(Cl)c([C@@H](C)Oc2ccc3c(c2)c(-c2ccc(Cl)nc2)nn3C2CCCCO2)c1Cl |
| InChI | InChI=1S/C25H23Cl3N4O2/c1-14-24(28)23(19(26)13-29-14)15(2)34-17-7-8-20-18(11-17)25(16-6-9-21(27)30-12-16)31-32(20)22-5-3-4-10-33-22/h6-9,11-13,15,22H,3-5,10H2,1-2H3/t15-,22?/m1/s1 |
| InChIKey | WWGBESPIPQVNJR-JGHKVMFLSA-N |
| XLogP | 7.60 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.84 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|