C22H25N5O2SSi — CID 66854578
N-pyridin-4-yl-5-(1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide (PubChem CID 66854578) has the molecular formula C22H25N5O2SSi and a molecular weight of 451.63 g/mol. Its IUPAC name is N-pyridin-4-yl-5-(1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide.
| Compound Name | N-pyridin-4-yl-5-(1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 66854578 |
| Molecular Formula | C22H25N5O2SSi |
| Molecular Weight | 451.63 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-pyridin-4-yl-5-(1,3-thiazol-5-yl)-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)Nc2ccncc2)c2cc(-c3cncs3)ccc21 |
| InChI | InChI=1S/C22H25N5O2SSi/c1-31(2,3)11-10-29-15-27-19-5-4-16(20-13-24-14-30-20)12-18(19)21(26-27)22(28)25-17-6-8-23-9-7-17/h4-9,12-14H,10-11,15H2,1-3H3,(H,23,25,28) |
| InChIKey | XRFDPKCVECFWQL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|