C18H22BrN5O2SSi — CID 90149320
N-[4-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 90149320) has the molecular formula C18H22BrN5O2SSi and a molecular weight of 480.46 g/mol. Its IUPAC name is N-[4-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 90149320 |
| Molecular Formula | C18H22BrN5O2SSi |
| Molecular Weight | 480.46 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | N-[4-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)nc1-c1ccc(NC(=O)c2cscn2)cc1 |
| InChI | InChI=1S/C18H22BrN5O2SSi/c1-28(2,3)9-8-26-12-24-16(22-18(19)23-24)13-4-6-14(7-5-13)21-17(25)15-10-27-11-20-15/h4-7,10-11H,8-9,12H2,1-3H3,(H,21,25) |
| InChIKey | RBRZPBOIQUPLCK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|