C12H11N3O3S — CID 62045992
N-[4-(2-amino-2-oxoethoxy)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 62045992) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62045992 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)COc1ccc(NC(=O)c2cscn2)cc1 |
| InChI | InChI=1S/C12H11N3O3S/c13-11(16)5-18-9-3-1-8(2-4-9)15-12(17)10-6-19-7-14-10/h1-4,6-7H,5H2,(H2,13,16)(H,15,17) |
| InChIKey | AEZZCFGZJXAIAY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |