C6H7N3O3S — CID 112550667
N-(2-amino-2-oxoethoxy)-1,3-thiazole-4-carboxamide (PubChem CID 112550667) has the molecular formula C6H7N3O3S and a molecular weight of 201.21 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 112550667 |
| Molecular Formula | C6H7N3O3S |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)CONC(=O)c1cscn1 |
| InChI | InChI=1S/C6H7N3O3S/c7-5(10)1-12-9-6(11)4-2-13-3-8-4/h2-3H,1H2,(H2,7,10)(H,9,11) |
| InChIKey | XYBUFFIJTKWZOG-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|