C5H8Cl2N2OS — CID 175705206
N-methyl-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 175705206) has the molecular formula C5H8Cl2N2OS and a molecular weight of 215.11 g/mol. Its IUPAC name is N-methyl-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | N-methyl-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 175705206 |
| Molecular Formula | C5H8Cl2N2OS |
| Molecular Weight | 215.11 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | N-methyl-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | CNC(=O)c1cscn1.Cl.Cl |
| InChI | InChI=1S/C5H6N2OS.2ClH/c1-6-5(8)4-2-9-3-7-4;;/h2-3H,1H3,(H,6,8);2*1H |
| InChIKey | ANCGUMFYLSUDSQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.11 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |