C9H13N3O2S — CID 84557796
N-(3-acetamidopropyl)-1,3-thiazole-4-carboxamide (PubChem CID 84557796) has the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. Its IUPAC name is N-(3-acetamidopropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-acetamidopropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 84557796 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-(3-acetamidopropyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)NCCCNC(=O)c1cscn1 |
| InChI | InChI=1S/C9H13N3O2S/c1-7(13)10-3-2-4-11-9(14)8-5-15-6-12-8/h5-6H,2-4H2,1H3,(H,10,13)(H,11,14) |
| InChIKey | ZMXZDOHCOMQKER-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|