C7H8N2OS — CID 63038406
N-prop-2-enyl-1,3-thiazole-4-carboxamide (PubChem CID 63038406) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is N-prop-2-enyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-prop-2-enyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63038406 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | N-prop-2-enyl-1,3-thiazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1cscn1 |
| InChI | InChI=1S/C7H8N2OS/c1-2-3-8-7(10)6-4-11-5-9-6/h2,4-5H,1,3H2,(H,8,10) |
| InChIKey | HTVASJNMSCOCGO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|