C8H9ClN2OS — CID 81428963
N-[(E)-4-chlorobut-2-enyl]-1,3-thiazole-4-carboxamide (PubChem CID 81428963) has the molecular formula C8H9ClN2OS and a molecular weight of 216.69 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 81428963 |
| Molecular Formula | C8H9ClN2OS |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC/C=C/CCl)c1cscn1 |
| InChI | InChI=1S/C8H9ClN2OS/c9-3-1-2-4-10-8(12)7-5-13-6-11-7/h1-2,5-6H,3-4H2,(H,10,12)/b2-1+ |
| InChIKey | SZNOSUROFVOHKP-OWOJBTEDSA-N |
| XLogP | 1.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|