C6H6N2O4S — CID 63913381
2-(1,3-thiazole-4-carbonylamino)oxyacetic acid (PubChem CID 63913381) has the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. Its IUPAC name is 2-(1,3-thiazole-4-carbonylamino)oxyacetic acid.
| Compound Name | 2-(1,3-thiazole-4-carbonylamino)oxyacetic acid |
|---|---|
| PubChem CID | 63913381 |
| Molecular Formula | C6H6N2O4S |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.00 |
| IUPAC Name | 2-(1,3-thiazole-4-carbonylamino)oxyacetic acid |
| SMILES | O=C(O)CONC(=O)c1cscn1 |
| InChI | InChI=1S/C6H6N2O4S/c9-5(10)1-12-8-6(11)4-2-13-3-7-4/h2-3H,1H2,(H,8,11)(H,9,10) |
| InChIKey | AJDWWZYCUNGCPQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|